C19H18Cl4N2O2 — CID 4842606
3,4-dichloro-N-[3-[(3,4-dichlorobenzoyl)amino]pentyl]benzamide (PubChem CID 4842606) has the molecular formula C19H18Cl4N2O2 and a molecular weight of 448.18 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[(3,4-dichlorobenzoyl)amino]pentyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[(3,4-dichlorobenzoyl)amino]pentyl]benzamide |
|---|---|
| PubChem CID | 4842606 |
| Molecular Formula | C19H18Cl4N2O2 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 3,4-dichloro-N-[3-[(3,4-dichlorobenzoyl)amino]pentyl]benzamide |
| SMILES | CCC(CCNC(=O)c1ccc(Cl)c(Cl)c1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl4N2O2/c1-2-13(25-19(27)12-4-6-15(21)17(23)10-12)7-8-24-18(26)11-3-5-14(20)16(22)9-11/h3-6,9-10,13H,2,7-8H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | ZVTYDIUMWWARGO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |