C12H13Cl2NO3 — CID 82322800
4-(3,4-dichlorophenyl)-3-(ethylamino)-4-oxobutanoic acid (PubChem CID 82322800) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-(ethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(3,4-dichlorophenyl)-3-(ethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82322800 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-(ethylamino)-4-oxobutanoic acid |
| SMILES | CCNC(CC(=O)O)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-2-15-10(6-11(16)17)12(18)7-3-4-8(13)9(14)5-7/h3-5,10,15H,2,6H2,1H3,(H,16,17) |
| InChIKey | MDNXENRIJJAWCP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |