C12H11Cl2NO — CID 79405268
2-(3,4-dichlorobenzoyl)pentanenitrile (PubChem CID 79405268) has the molecular formula C12H11Cl2NO and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-(3,4-dichlorobenzoyl)pentanenitrile.
| Compound Name | 2-(3,4-dichlorobenzoyl)pentanenitrile |
|---|---|
| PubChem CID | 79405268 |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-(3,4-dichlorobenzoyl)pentanenitrile |
| SMILES | CCCC(C#N)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NO/c1-2-3-9(7-15)12(16)8-4-5-10(13)11(14)6-8/h4-6,9H,2-3H2,1H3 |
| InChIKey | MIFCTAJUMDYTMV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|