C12H14Cl2O2 — CID 103453814
1-(3,4-dichlorophenyl)-3-hydroxyhexan-2-one (PubChem CID 103453814) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-hydroxyhexan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-hydroxyhexan-2-one |
|---|---|
| PubChem CID | 103453814 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-hydroxyhexan-2-one |
| SMILES | CCCC(O)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2O2/c1-2-3-11(15)12(16)7-8-4-5-9(13)10(14)6-8/h4-6,11,15H,2-3,7H2,1H3 |
| InChIKey | XMOSTTAYAQCRGT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |