C11H13Cl2NO — CID 116583907
3-amino-1-(3,4-dichlorophenyl)pentan-2-one (PubChem CID 116583907) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 3-amino-1-(3,4-dichlorophenyl)pentan-2-one.
| Compound Name | 3-amino-1-(3,4-dichlorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 116583907 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-amino-1-(3,4-dichlorophenyl)pentan-2-one |
| SMILES | CCC(N)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-2-10(14)11(15)6-7-3-4-8(12)9(13)5-7/h3-5,10H,2,6,14H2,1H3 |
| InChIKey | DKHZDMWWHYGNBY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |