C14H18Cl2N2O2 — CID 78773290
2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanamide (PubChem CID 78773290) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanamide.
| Compound Name | 2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 78773290 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)Cc1ccc(Cl)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-3-8(2)13(14(17)20)18-12(19)7-9-4-5-10(15)11(16)6-9/h4-6,8,13H,3,7H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | FNTFHUSJAQTWGQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |