C16H21Cl2NO3 — CID 67636937
butyl 2-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoate (PubChem CID 67636937) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is butyl 2-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoate.
| Compound Name | butyl 2-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 67636937 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | butyl 2-[[2-(3,4-dichlorophenyl)acetyl]amino]butanoate |
| SMILES | CCCCOC(=O)C(CC)NC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO3/c1-3-5-8-22-16(21)14(4-2)19-15(20)10-11-6-7-12(17)13(18)9-11/h6-7,9,14H,3-5,8,10H2,1-2H3,(H,19,20) |
| InChIKey | ZQYWPSBSEOXJPZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|