C11H12Cl2N2OS — CID 63044929
N-(1-amino-1-sulfanylidenepropan-2-yl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 63044929) has the molecular formula C11H12Cl2N2OS and a molecular weight of 291.20 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 63044929 |
| Molecular Formula | C11H12Cl2N2OS |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc(Cl)c(Cl)c1)C(N)=S |
| InChI | InChI=1S/C11H12Cl2N2OS/c1-6(11(14)17)15-10(16)5-7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | VQKOAGLZZHLWFA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|