C14H17Cl2NO3 — CID 61172231
(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanoic acid (PubChem CID 61172231) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61172231 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2S)-2-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)Cc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO3/c1-3-8(2)13(14(19)20)17-12(18)7-9-4-5-10(15)11(16)6-9/h4-6,8,13H,3,7H2,1-2H3,(H,17,18)(H,19,20)/t8?,13-/m0/s1 |
| InChIKey | UVRGVXQCCBDQGK-RLROJCQXSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |