C19H23NO3 — CID 102138109
butyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate (PubChem CID 102138109) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is butyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate.
| Compound Name | butyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 102138109 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | butyl (2S)-2-acetamido-3-naphthalen-2-ylpropanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc2ccccc2c1)NC(C)=O |
| InChI | InChI=1S/C19H23NO3/c1-3-4-11-23-19(22)18(20-14(2)21)13-15-9-10-16-7-5-6-8-17(16)12-15/h5-10,12,18H,3-4,11,13H2,1-2H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | CXYDTTAPVZLJIH-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|