C22H29NO3 — CID 139753327
3-naphthalen-2-yl-2-(nonanoylamino)propanoic acid (PubChem CID 139753327) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-naphthalen-2-yl-2-(nonanoylamino)propanoic acid.
| Compound Name | 3-naphthalen-2-yl-2-(nonanoylamino)propanoic acid |
|---|---|
| PubChem CID | 139753327 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3-naphthalen-2-yl-2-(nonanoylamino)propanoic acid |
| SMILES | CCCCCCCCC(=O)NC(Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C22H29NO3/c1-2-3-4-5-6-7-12-21(24)23-20(22(25)26)16-17-13-14-18-10-8-9-11-19(18)15-17/h8-11,13-15,20H,2-7,12,16H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | MUNRZQVSRNELSE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|