C27H32N2O2 — CID 140518662
N-[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]heptanamide (PubChem CID 140518662) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]heptanamide.
| Compound Name | N-[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]heptanamide |
|---|---|
| PubChem CID | 140518662 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N-[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O2/c1-2-3-4-8-15-26(30)29-25(27(31)28-20-21-11-6-5-7-12-21)19-22-16-17-23-13-9-10-14-24(23)18-22/h5-7,9-14,16-18,25H,2-4,8,15,19-20H2,1H3,(H,28,31)(H,29,30)/t25-/m0/s1 |
| InChIKey | QNEHJSHSZWBHLT-VWLOTQADSA-N |
| XLogP | 5.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|