C25H32N2O5 — CID 118429218
butyl (2S,3R)-2-[[(2S)-1-methoxy-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]-3-methylpyrrolidine-1-carboxylate (PubChem CID 118429218) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is butyl (2S,3R)-2-[[(2S)-1-methoxy-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | butyl (2S,3R)-2-[[(2S)-1-methoxy-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118429218 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | butyl (2S,3R)-2-[[(2S)-1-methoxy-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC[C@@H](C)[C@H]1C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)OC |
| InChI | InChI=1S/C25H32N2O5/c1-4-5-14-32-25(30)27-13-12-17(2)22(27)23(28)26-21(24(29)31-3)16-18-10-11-19-8-6-7-9-20(19)15-18/h6-11,15,17,21-22H,4-5,12-14,16H2,1-3H3,(H,26,28)/t17-,21+,22+/m1/s1 |
| InChIKey | PCNUWYOXLZQPLW-WTNAPCKOSA-N |
| XLogP | 3.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|