C27H21NO3 — CID 102461690
methyl 3-naphthalen-2-yl-2-(3-naphthalen-2-ylprop-2-ynoylamino)propanoate (PubChem CID 102461690) has the molecular formula C27H21NO3 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 3-naphthalen-2-yl-2-(3-naphthalen-2-ylprop-2-ynoylamino)propanoate.
| Compound Name | methyl 3-naphthalen-2-yl-2-(3-naphthalen-2-ylprop-2-ynoylamino)propanoate |
|---|---|
| PubChem CID | 102461690 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 3-naphthalen-2-yl-2-(3-naphthalen-2-ylprop-2-ynoylamino)propanoate |
| SMILES | COC(=O)C(Cc1ccc2ccccc2c1)NC(=O)C#Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21NO3/c1-31-27(30)25(18-20-11-14-22-7-3-5-9-24(22)17-20)28-26(29)15-12-19-10-13-21-6-2-4-8-23(21)16-19/h2-11,13-14,16-17,25H,18H2,1H3,(H,28,29) |
| InChIKey | LMUNVDFQFWRWNA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|