C23H21NO — CID 66634823
N-[1-[4-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]acetamide (PubChem CID 66634823) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[1-[4-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]acetamide.
| Compound Name | N-[1-[4-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 66634823 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[1-[4-(2-naphthalen-2-ylethynyl)phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cc1ccc(C#Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-17(24-18(2)25)15-20-10-7-19(8-11-20)9-12-21-13-14-22-5-3-4-6-23(22)16-21/h3-8,10-11,13-14,16-17H,15H2,1-2H3,(H,24,25) |
| InChIKey | MKNXQSGUSOCENW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|