C18H23NO — CID 157258470
N-(1-phenylpropan-2-yl)acetamide;toluene (PubChem CID 157258470) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(1-phenylpropan-2-yl)acetamide;toluene.
| Compound Name | N-(1-phenylpropan-2-yl)acetamide;toluene |
|---|---|
| PubChem CID | 157258470 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-(1-phenylpropan-2-yl)acetamide;toluene |
| SMILES | CC(=O)NC(C)Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO.C7H8/c1-9(12-10(2)13)8-11-6-4-3-5-7-11;1-7-5-3-2-4-6-7/h3-7,9H,8H2,1-2H3,(H,12,13);2-6H,1H3 |
| InChIKey | AXEBVIWMWYZZKJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |