C14H23NO3 — CID 177356857
ethane;formic acid;N-(1-phenylpropan-2-yl)acetamide (PubChem CID 177356857) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethane;formic acid;N-(1-phenylpropan-2-yl)acetamide.
| Compound Name | ethane;formic acid;N-(1-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 177356857 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethane;formic acid;N-(1-phenylpropan-2-yl)acetamide |
| SMILES | CC.CC(=O)NC(C)Cc1ccccc1.O=CO |
| InChI | InChI=1S/C11H15NO.C2H6.CH2O2/c1-9(12-10(2)13)8-11-6-4-3-5-7-11;1-2;2-1-3/h3-7,9H,8H2,1-2H3,(H,12,13);1-2H3;1H,(H,2,3) |
| InChIKey | ACXVEJKBXJRSHS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|