C25H26N2O2 — CID 159102988
methane;N-[(2S)-1-[4-[2-(6-phenoxy-3-pyridinyl)ethynyl]phenyl]propan-2-yl]acetamide (PubChem CID 159102988) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methane;N-[(2S)-1-[4-[2-(6-phenoxy-3-pyridinyl)ethynyl]phenyl]propan-2-yl]acetamide.
| Compound Name | methane;N-[(2S)-1-[4-[2-(6-phenoxy-3-pyridinyl)ethynyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 159102988 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methane;N-[(2S)-1-[4-[2-(6-phenoxy-3-pyridinyl)ethynyl]phenyl]propan-2-yl]acetamide |
| SMILES | C.CC(=O)N[C@@H](C)Cc1ccc(C#Cc2ccc(Oc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C24H22N2O2.CH4/c1-18(26-19(2)27)16-21-11-8-20(9-12-21)10-13-22-14-15-24(25-17-22)28-23-6-4-3-5-7-23;/h3-9,11-12,14-15,17-18H,16H2,1-2H3,(H,26,27);1H4/t18-;/m0./s1 |
| InChIKey | KDNCGAQCILRORD-FERBBOLQSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|