C20H21F3N4O — CID 66635165
N-[1-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]propan-2-yl]acetamide (PubChem CID 66635165) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[1-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]propan-2-yl]acetamide.
| Compound Name | N-[1-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 66635165 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[1-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cc1ccc(C#Cc2cnc(NCCC(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C20H21F3N4O/c1-14(27-15(2)28)11-17-6-3-16(4-7-17)5-8-18-12-25-19(26-13-18)24-10-9-20(21,22)23/h3-4,6-7,12-14H,9-11H2,1-2H3,(H,27,28)(H,24,25,26) |
| InChIKey | FTGDHOMMZRUQSG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|