C32H27NO5 — CID 68943123
methyl 2-[(2-methoxy-2-oxoethyl)-(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-phenylphenyl)propanoate (PubChem CID 68943123) has the molecular formula C32H27NO5 and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 68943123 |
| Molecular Formula | C32H27NO5 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)CN(C(=O)C#Cc1ccc2ccccc2c1)C(Cc1ccc(-c2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C32H27NO5/c1-37-31(35)22-33(30(34)19-15-23-12-16-26-10-6-7-11-28(26)20-23)29(32(36)38-2)21-24-13-17-27(18-14-24)25-8-4-3-5-9-25/h3-14,16-18,20,29H,21-22H2,1-2H3 |
| InChIKey | JNWLUHIOGFHPKL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|