C29H22N2O5 — CID 101104912
2-[carboxymethyl(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-pyridin-2-ylphenyl)propanoic acid (PubChem CID 101104912) has the molecular formula C29H22N2O5 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[carboxymethyl(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-pyridin-2-ylphenyl)propanoic acid.
| Compound Name | 2-[carboxymethyl(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-pyridin-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 101104912 |
| Molecular Formula | C29H22N2O5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[carboxymethyl(3-naphthalen-2-ylprop-2-ynoyl)amino]-3-(4-pyridin-2-ylphenyl)propanoic acid |
| SMILES | O=C(O)CN(C(=O)C#Cc1ccc2ccccc2c1)C(Cc1ccc(-c2ccccn2)cc1)C(=O)O |
| InChI | InChI=1S/C29H22N2O5/c32-27(15-11-20-8-12-22-5-1-2-6-24(22)17-20)31(19-28(33)34)26(29(35)36)18-21-9-13-23(14-10-21)25-7-3-4-16-30-25/h1-10,12-14,16-17,26H,18-19H2,(H,33,34)(H,35,36) |
| InChIKey | DCLRLAZSGVPGAH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|