C13H15NNaO6+ — CID 20524802
sodium 2-[bis(carboxymethyl)amino]-3-phenylpropanoic acid (PubChem CID 20524802) has the molecular formula C13H15NNaO6+ and a molecular weight of 304.25 g/mol. Its IUPAC name is sodium 2-[bis(carboxymethyl)amino]-3-phenylpropanoic acid.
| Compound Name | sodium 2-[bis(carboxymethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 20524802 |
| Molecular Formula | C13H15NNaO6+ |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | sodium 2-[bis(carboxymethyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(Cc1ccccc1)C(=O)O.[Na+] |
| InChI | InChI=1S/C13H15NO6.Na/c15-11(16)7-14(8-12(17)18)10(13(19)20)6-9-4-2-1-3-5-9;/h1-5,10H,6-8H2,(H,15,16)(H,17,18)(H,19,20);/q;+1 |
| InChIKey | RQFHGNYSHKTJOR-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |