C21H29N3O10 — CID 51032861
2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-3-phenylpropanoic acid (PubChem CID 51032861) has the molecular formula C21H29N3O10 and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 51032861 |
| Molecular Formula | C21H29N3O10 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)C(Cc1ccccc1)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C21H29N3O10/c25-17(26)11-22(12-18(27)28)6-8-24(9-7-23(13-19(29)30)14-20(31)32)16(21(33)34)10-15-4-2-1-3-5-15/h1-5,16H,6-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | YIYCUMAHCGOJRV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 196.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |