C24H32N2O8 — CID 20717309
2-[carboxymethyl-[2-[2-hydroperoxyethyl-(1-hydroperoxy-3-phenylpropan-2-yl)amino]ethyl]amino]-3-phenylpropanoic acid (PubChem CID 20717309) has the molecular formula C24H32N2O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[2-hydroperoxyethyl-(1-hydroperoxy-3-phenylpropan-2-yl)amino]ethyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[carboxymethyl-[2-[2-hydroperoxyethyl-(1-hydroperoxy-3-phenylpropan-2-yl)amino]ethyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 20717309 |
| Molecular Formula | C24H32N2O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[carboxymethyl-[2-[2-hydroperoxyethyl-(1-hydroperoxy-3-phenylpropan-2-yl)amino]ethyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CN(CCN(CCOO)C(COO)Cc1ccccc1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H32N2O8/c27-23(28)17-26(22(24(29)30)16-20-9-5-2-6-10-20)12-11-25(13-14-33-31)21(18-34-32)15-19-7-3-1-4-8-19/h1-10,21-22,31-32H,11-18H2,(H,27,28)(H,29,30) |
| InChIKey | FIHMSZOQBIIEMK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|