C20H30N4O9S — CID 87470425
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid;2-hydroxyethylthiourea (PubChem CID 87470425) has the molecular formula C20H30N4O9S and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid;2-hydroxyethylthiourea.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid;2-hydroxyethylthiourea |
|---|---|
| PubChem CID | 87470425 |
| Molecular Formula | C20H30N4O9S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid;2-hydroxyethylthiourea |
| SMILES | NC(=S)NCCO.O=C(O)CN(CCN(CC(=O)O)C(Cc1ccccc1)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C17H22N2O8.C3H8N2OS/c20-14(21)9-18(10-15(22)23)6-7-19(11-16(24)25)13(17(26)27)8-12-4-2-1-3-5-12;4-3(7)5-1-2-6/h1-5,13H,6-11H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27);6H,1-2H2,(H3,4,5,7) |
| InChIKey | FMWQNWUHNJOILW-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 213.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|