C12H18N2O10 — CID 21458914
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]butanedioic acid (PubChem CID 21458914) has the molecular formula C12H18N2O10 and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]butanedioic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 21458914 |
| Molecular Formula | C12H18N2O10 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H18N2O10/c15-8(16)3-7(12(23)24)14(6-11(21)22)2-1-13(4-9(17)18)5-10(19)20/h7H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | KVNHXLUIZLCSHE-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 192.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |