C17H22N2O8 — CID 20717319
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid (PubChem CID 20717319) has the molecular formula C17H22N2O8 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 20717319 |
| Molecular Formula | C17H22N2O8 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)C(Cc1ccccc1)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C17H22N2O8/c20-14(21)9-18(10-15(22)23)6-7-19(11-16(24)25)13(17(26)27)8-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | UBSFJCPIWSELPN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |