C11H17NO8P2 — CID 23728656
2-[bis(phosphonomethyl)amino]-3-phenylpropanoic acid (PubChem CID 23728656) has the molecular formula C11H17NO8P2 and a molecular weight of 353.20 g/mol. Its IUPAC name is 2-[bis(phosphonomethyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[bis(phosphonomethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 23728656 |
| Molecular Formula | C11H17NO8P2 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-[bis(phosphonomethyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C11H17NO8P2/c13-11(14)10(6-9-4-2-1-3-5-9)12(7-21(15,16)17)8-22(18,19)20/h1-5,10H,6-8H2,(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | ALYFABUHACFEIA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|