About boric acid;2-naphthalen-2-ylpyridine
boric acid;2-naphthalen-2-ylpyridine (PubChem CID 175005821) has the molecular formula C15H14BNO3
and a molecular weight of 267.09 g/mol. Its IUPAC name is boric acid;2-naphthalen-2-ylpyridine.
Molecular Properties
| Compound Name | boric acid;2-naphthalen-2-ylpyridine |
| PubChem CID | 175005821 |
| Molecular Formula | C15H14BNO3 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | boric acid;2-naphthalen-2-ylpyridine |
| SMILES | OB(O)O.c1ccc(-c2ccc3ccccc3c2)nc1 |
| InChI | InChI=1S/C15H11N.BH3O3/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15;2-1(3)4/h1-11H;2-4H |
| InChIKey | ZLPHWDAUZMTPRB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2-naphthalen-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2-naphthalen-2-ylpyridine?
The IUPAC name of boric acid;2-naphthalen-2-ylpyridine (CID 175005821) is boric acid;2-naphthalen-2-ylpyridine.
What is the SMILES notation for boric acid;2-naphthalen-2-ylpyridine?
The canonical SMILES for boric acid;2-naphthalen-2-ylpyridine is OB(O)O.c1ccc(-c2ccc3ccccc3c2)nc1.
What is the InChIKey of boric acid;2-naphthalen-2-ylpyridine?
The InChIKey is ZLPHWDAUZMTPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.BH3O3/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15;2-1(3)4/h1-11H;2-4H.
What are the key properties of boric acid;2-naphthalen-2-ylpyridine?
boric acid;2-naphthalen-2-ylpyridine has a molecular weight of 267.09 g/mol, XLogP of 1.85, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2-naphthalen-2-ylpyridine is sourced from PubChem (CID 175005821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).