C37H35N3O — CID 67406268
(Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-(4-pyridin-2-ylphenyl)hex-4-en-3-one (PubChem CID 67406268) has the molecular formula C37H35N3O and a molecular weight of 537.71 g/mol. Its IUPAC name is (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-(4-pyridin-2-ylphenyl)hex-4-en-3-one.
| Compound Name | (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-(4-pyridin-2-ylphenyl)hex-4-en-3-one |
|---|---|
| PubChem CID | 67406268 |
| Molecular Formula | C37H35N3O |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-(4-pyridin-2-ylphenyl)hex-4-en-3-one |
| SMILES | N/C(=C\C(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)Cc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C37H35N3O/c38-34(24-30-19-21-33(22-20-30)35-18-10-11-23-39-35)26-37(41)36(25-29-12-4-1-5-13-29)40(27-31-14-6-2-7-15-31)28-32-16-8-3-9-17-32/h1-23,26,36H,24-25,27-28,38H2/b34-26-/t36-/m0/s1 |
| InChIKey | DRMHXTPMEBBXEU-IJMVTRQJSA-N |
| XLogP | 7.02 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|