C31H31N3O — CID 139069206
(Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-pyridin-2-ylhex-4-en-3-one (PubChem CID 139069206) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-pyridin-2-ylhex-4-en-3-one.
| Compound Name | (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-pyridin-2-ylhex-4-en-3-one |
|---|---|
| PubChem CID | 139069206 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (Z,2S)-5-amino-2-(dibenzylamino)-1-phenyl-6-pyridin-2-ylhex-4-en-3-one |
| SMILES | N/C(=C\C(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C31H31N3O/c32-28(21-29-18-10-11-19-33-29)22-31(35)30(20-25-12-4-1-5-13-25)34(23-26-14-6-2-7-15-26)24-27-16-8-3-9-17-27/h1-19,22,30H,20-21,23-24,32H2/b28-22-/t30-/m0/s1 |
| InChIKey | IGTIYVPMHWLKRG-UGDULNSISA-N |
| XLogP | 5.35 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|