C17H20N2O4S — CID 167889643
methyl (2R)-2-[methyl(pyridin-2-ylmethylsulfonyl)amino]-3-phenylpropanoate (PubChem CID 167889643) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is methyl (2R)-2-[methyl(pyridin-2-ylmethylsulfonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[methyl(pyridin-2-ylmethylsulfonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 167889643 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl (2R)-2-[methyl(pyridin-2-ylmethylsulfonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N(C)S(=O)(=O)Cc1ccccn1 |
| InChI | InChI=1S/C17H20N2O4S/c1-19(24(21,22)13-15-10-6-7-11-18-15)16(17(20)23-2)12-14-8-4-3-5-9-14/h3-11,16H,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | VOAYCWJQZBKDOT-MRXNPFEDSA-N |
| XLogP | 1.63 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |