C18H19NO3 — CID 11781471
methyl (2R)-2-[benzoyl(methyl)amino]-3-phenylpropanoate (PubChem CID 11781471) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl (2R)-2-[benzoyl(methyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[benzoyl(methyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11781471 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl (2R)-2-[benzoyl(methyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-19(17(20)15-11-7-4-8-12-15)16(18(21)22-2)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | QSRSKZNJSUHUJA-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |