C19H20ClNO4 — CID 102387641
methyl (2S)-2-(N-(2-chloroacetyl)-4-methoxyanilino)-3-phenylpropanoate (PubChem CID 102387641) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl (2S)-2-(N-(2-chloroacetyl)-4-methoxyanilino)-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-(N-(2-chloroacetyl)-4-methoxyanilino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102387641 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl (2S)-2-(N-(2-chloroacetyl)-4-methoxyanilino)-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N(C(=O)CCl)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20ClNO4/c1-24-16-10-8-15(9-11-16)21(18(22)13-20)17(19(23)25-2)12-14-6-4-3-5-7-14/h3-11,17H,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | GIOHDFCJMLPYCP-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|