C28H30ClNO5 — CID 56642546
methyl (2S)-2-[[(2S)-2-chloropropanoyl]-[(4-methoxyphenyl)methyl]amino]-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 56642546) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-chloropropanoyl]-[(4-methoxyphenyl)methyl]amino]-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-chloropropanoyl]-[(4-methoxyphenyl)methyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 56642546 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-chloropropanoyl]-[(4-methoxyphenyl)methyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)N(Cc1ccc(OC)cc1)C(=O)[C@H](C)Cl |
| InChI | InChI=1S/C28H30ClNO5/c1-20(29)27(31)30(18-22-11-13-24(33-2)14-12-22)26(28(32)34-3)17-21-9-15-25(16-10-21)35-19-23-7-5-4-6-8-23/h4-16,20,26H,17-19H2,1-3H3/t20-,26-/m0/s1 |
| InChIKey | PAULQFBIKCSRKI-FNZWTVRRSA-N |
| XLogP | 5.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|