C27H28N2O7 — CID 143560120
methyl 3-(4-methoxyphenyl)-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate (PubChem CID 143560120) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is methyl 3-(4-methoxyphenyl)-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate.
| Compound Name | methyl 3-(4-methoxyphenyl)-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
|---|---|
| PubChem CID | 143560120 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | methyl 3-(4-methoxyphenyl)-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC)cc1)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O7/c1-33-23-15-13-20(14-16-23)17-24(25(30)34-2)29(27(32)36-19-22-11-7-4-8-12-22)28-26(31)35-18-21-9-5-3-6-10-21/h3-16,24H,17-19H2,1-2H3,(H,28,31) |
| InChIKey | VRTZIULPYIMYFN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|