C25H24N2O6 — CID 101057216
phenyl 2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate (PubChem CID 101057216) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is phenyl 2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate.
| Compound Name | phenyl 2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
|---|---|
| PubChem CID | 101057216 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | phenyl 2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
| SMILES | CC(C(=O)Oc1ccccc1)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O6/c1-19(23(28)33-22-15-9-4-10-16-22)27(25(30)32-18-21-13-7-3-8-14-21)26-24(29)31-17-20-11-5-2-6-12-20/h2-16,19H,17-18H2,1H3,(H,26,29) |
| InChIKey | VRADUZNTTRKWRQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|