C27H28N2O4 — CID 139683849
benzyl N-[[(2S)-3-oxo-1-phenylbutan-2-yl]-(3-phenylpropanoyl)amino]carbamate (PubChem CID 139683849) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is benzyl N-[[(2S)-3-oxo-1-phenylbutan-2-yl]-(3-phenylpropanoyl)amino]carbamate.
| Compound Name | benzyl N-[[(2S)-3-oxo-1-phenylbutan-2-yl]-(3-phenylpropanoyl)amino]carbamate |
|---|---|
| PubChem CID | 139683849 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | benzyl N-[[(2S)-3-oxo-1-phenylbutan-2-yl]-(3-phenylpropanoyl)amino]carbamate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)N(NC(=O)OCc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-21(30)25(19-23-13-7-3-8-14-23)29(26(31)18-17-22-11-5-2-6-12-22)28-27(32)33-20-24-15-9-4-10-16-24/h2-16,25H,17-20H2,1H3,(H,28,32)/t25-/m0/s1 |
| InChIKey | MDVVCQHNABSLCO-VWLOTQADSA-N |
| XLogP | 4.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|