C27H32N2O6S — CID 18941370
furan-2-ylmethyl N-[[4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-(4-methylpentanoyl)amino]carbamate (PubChem CID 18941370) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is furan-2-ylmethyl N-[[4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-(4-methylpentanoyl)amino]carbamate.
| Compound Name | furan-2-ylmethyl N-[[4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-(4-methylpentanoyl)amino]carbamate |
|---|---|
| PubChem CID | 18941370 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | furan-2-ylmethyl N-[[4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-(4-methylpentanoyl)amino]carbamate |
| SMILES | CC(C)CCC(=O)N(NC(=O)OCc1ccco1)C(Cc1ccccc1)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C27H32N2O6S/c1-20(2)12-13-26(31)29(28-27(32)35-17-22-10-6-14-33-22)24(16-21-8-4-3-5-9-21)25(30)19-36-18-23-11-7-15-34-23/h3-11,14-15,20,24H,12-13,16-19H2,1-2H3,(H,28,32) |
| InChIKey | FFWCNMWRIKRDEZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|