C20H26N2O6 — CID 141117139
(2S)-2-[3-cyclopentylpropanoyl(phenylmethoxycarbonylamino)amino]-4-oxobutanoic acid (PubChem CID 141117139) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is (2S)-2-[3-cyclopentylpropanoyl(phenylmethoxycarbonylamino)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-[3-cyclopentylpropanoyl(phenylmethoxycarbonylamino)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141117139 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2S)-2-[3-cyclopentylpropanoyl(phenylmethoxycarbonylamino)amino]-4-oxobutanoic acid |
| SMILES | O=CC[C@@H](C(=O)O)N(NC(=O)OCc1ccccc1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C20H26N2O6/c23-13-12-17(19(25)26)22(18(24)11-10-15-6-4-5-7-15)21-20(27)28-14-16-8-2-1-3-9-16/h1-3,8-9,13,15,17H,4-7,10-12,14H2,(H,21,27)(H,25,26)/t17-/m0/s1 |
| InChIKey | NBPPNIZGOTYFSC-KRWDZBQOSA-N |
| XLogP | 2.67 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|