C24H30N2O6 — CID 58017413
benzyl N-[(2S)-1-hydroxy-3-(oxan-3-yl)propan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 58017413) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-hydroxy-3-(oxan-3-yl)propan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2S)-1-hydroxy-3-(oxan-3-yl)propan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 58017413 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | benzyl N-[(2S)-1-hydroxy-3-(oxan-3-yl)propan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)[C@H](CO)CC1CCCOC1)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O6/c27-15-22(14-21-12-7-13-30-16-21)26(24(29)32-18-20-10-5-2-6-11-20)25-23(28)31-17-19-8-3-1-4-9-19/h1-6,8-11,21-22,27H,7,12-18H2,(H,25,28)/t21?,22-/m0/s1 |
| InChIKey | WWPWJVLEFGBQNB-KEKNWZKVSA-N |
| XLogP | 3.64 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|