C22H30N2O6 — CID 69324450
benzyl N-[3-cyclopentylpropanoyl-[(2R)-2-ethoxy-5-oxooxolan-2-yl]amino]carbamate (PubChem CID 69324450) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is benzyl N-[3-cyclopentylpropanoyl-[(2R)-2-ethoxy-5-oxooxolan-2-yl]amino]carbamate.
| Compound Name | benzyl N-[3-cyclopentylpropanoyl-[(2R)-2-ethoxy-5-oxooxolan-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 69324450 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | benzyl N-[3-cyclopentylpropanoyl-[(2R)-2-ethoxy-5-oxooxolan-2-yl]amino]carbamate |
| SMILES | CCO[C@]1(N(NC(=O)OCc2ccccc2)C(=O)CCC2CCCC2)CCC(=O)O1 |
| InChI | InChI=1S/C22H30N2O6/c1-2-29-22(15-14-20(26)30-22)24(19(25)13-12-17-8-6-7-9-17)23-21(27)28-16-18-10-4-3-5-11-18/h3-5,10-11,17H,2,6-9,12-16H2,1H3,(H,23,27)/t22-/m1/s1 |
| InChIKey | PSXYRZLTMXCTEE-JOCHJYFZSA-N |
| XLogP | 3.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|