C22H22N2O7 — CID 102513618
benzyl N-[(3S)-3-acetyl-2-oxooxolan-3-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 102513618) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is benzyl N-[(3S)-3-acetyl-2-oxooxolan-3-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(3S)-3-acetyl-2-oxooxolan-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102513618 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | benzyl N-[(3S)-3-acetyl-2-oxooxolan-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC(=O)[C@@]1(N(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)CCOC1=O |
| InChI | InChI=1S/C22H22N2O7/c1-16(25)22(12-13-29-19(22)26)24(21(28)31-15-18-10-6-3-7-11-18)23-20(27)30-14-17-8-4-2-5-9-17/h2-11H,12-15H2,1H3,(H,23,27)/t22-/m0/s1 |
| InChIKey | CGVLQLOCIJUXCT-QFIPXVFZSA-N |
| XLogP | 2.74 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|