C27H24N2O7 — CID 102406356
methyl 3-oxo-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]-1H-indene-2-carboxylate (PubChem CID 102406356) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is methyl 3-oxo-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]-1H-indene-2-carboxylate.
| Compound Name | methyl 3-oxo-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102406356 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methyl 3-oxo-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1(N(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C27H24N2O7/c1-34-24(31)27(16-21-14-8-9-15-22(21)23(27)30)29(26(33)36-18-20-12-6-3-7-13-20)28-25(32)35-17-19-10-4-2-5-11-19/h2-15H,16-18H2,1H3,(H,28,32) |
| InChIKey | YIFGUNWVEOWSKM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|