C18H22N2O8 — CID 45102454
methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-5-methoxy-3-oxo-1H-indene-2-carboxylate (PubChem CID 45102454) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-5-methoxy-3-oxo-1H-indene-2-carboxylate.
| Compound Name | methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-5-methoxy-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 45102454 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-5-methoxy-3-oxo-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@@]1(C(=O)OC)Cc2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C18H22N2O8/c1-5-27-16(23)19-20(17(24)28-6-2)18(15(22)26-4)10-11-7-8-12(25-3)9-13(11)14(18)21/h7-9H,5-6,10H2,1-4H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | RSUDEXDIFMTYPF-SFHVURJKSA-N |
| XLogP | 1.47 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|