C13H17NO3 — CID 45112147
ethyl (2R)-2-amino-5-methoxy-1,3-dihydroindene-2-carboxylate (PubChem CID 45112147) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl (2R)-2-amino-5-methoxy-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl (2R)-2-amino-5-methoxy-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 45112147 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl (2R)-2-amino-5-methoxy-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(N)Cc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C13H17NO3/c1-3-17-12(15)13(14)7-9-4-5-11(16-2)6-10(9)8-13/h4-6H,3,7-8,14H2,1-2H3/t13-/m1/s1 |
| InChIKey | JDOSICRNTWDKSP-CYBMUJFWSA-N |
| XLogP | 1.05 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |