C16H17NO2 — CID 10634763
ethyl 2-amino-1,3-dihydrophenalene-2-carboxylate (PubChem CID 10634763) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 2-amino-1,3-dihydrophenalene-2-carboxylate.
| Compound Name | ethyl 2-amino-1,3-dihydrophenalene-2-carboxylate |
|---|---|
| PubChem CID | 10634763 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl 2-amino-1,3-dihydrophenalene-2-carboxylate |
| SMILES | CCOC(=O)C1(N)Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C16H17NO2/c1-2-19-15(18)16(17)9-12-7-3-5-11-6-4-8-13(10-16)14(11)12/h3-8H,2,9-10,17H2,1H3 |
| InChIKey | DXHHTLACLQUVTL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |