C14H19NO4 — CID 91306842
ethyl 2-amino-4,7-dimethoxy-1,3-dihydroindene-2-carboxylate (PubChem CID 91306842) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 2-amino-4,7-dimethoxy-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-amino-4,7-dimethoxy-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 91306842 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 2-amino-4,7-dimethoxy-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(N)Cc2c(OC)ccc(OC)c2C1 |
| InChI | InChI=1S/C14H19NO4/c1-4-19-13(16)14(15)7-9-10(8-14)12(18-3)6-5-11(9)17-2/h5-6H,4,7-8,15H2,1-3H3 |
| InChIKey | BYLRPBPXKKNADJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |