About methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate
methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate (PubChem CID 122377038) has the molecular formula C21H20F3NO5
and a molecular weight of 423.39 g/mol. Its IUPAC name is methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate |
| PubChem CID | 122377038 |
| Molecular Formula | C21H20F3NO5 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1(C(Nc2ccc(OC)cc2)C(F)(F)F)Cc2ccc(OC)cc2C1=O |
| InChI | InChI=1S/C21H20F3NO5/c1-28-14-8-5-13(6-9-14)25-18(21(22,23)24)20(19(27)30-3)11-12-4-7-15(29-2)10-16(12)17(20)26/h4-10,18,25H,11H2,1-3H3 |
| InChIKey | IBQNITGUAJURPF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate?
The IUPAC name of methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate (CID 122377038) is methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate?
The canonical SMILES for methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate is COC(=O)C1(C(Nc2ccc(OC)cc2)C(F)(F)F)Cc2ccc(OC)cc2C1=O.
What is the InChIKey of methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate?
The InChIKey is IBQNITGUAJURPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO5/c1-28-14-8-5-13(6-9-14)25-18(21(22,23)24)20(19(27)30-3)11-12-4-7-15(29-2)10-16(12)17(20)26/h4-10,18,25H,11H2,1-3H3.
What are the key properties of methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate?
methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate has a molecular weight of 423.39 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-3-oxo-2-[2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]-1H-indene-2-carboxylate is sourced from PubChem (CID 122377038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).