C23H22F4N2O3 — CID 173148459
2,2,3,3-tetrafluoro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]propanamide (PubChem CID 173148459) has the molecular formula C23H22F4N2O3 and a molecular weight of 450.43 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 173148459 |
| Molecular Formula | C23H22F4N2O3 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]propanamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(NC(=O)C(F)(F)C(F)F)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C23H22F4N2O3/c1-22(2)12-14-6-9-16(32-3)10-17(14)18(29-22)11-19(30)13-4-7-15(8-5-13)28-21(31)23(26,27)20(24)25/h4-11,20,29H,12H2,1-3H3,(H,28,31) |
| InChIKey | SVLGLWRLFOLNRW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|